C21H25N3O2 — CID 166085943
3-[(1E,3Z)-1-amino-4-methyl-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-6,7-dimethyl-1,9-dihydrocyclohepta[d]pyrimidine-2,4-dione (PubChem CID 166085943) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[(1E,3Z)-1-amino-4-methyl-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-6,7-dimethyl-1,9-dihydrocyclohepta[d]pyrimidine-2,4-dione.
| Compound Name | 3-[(1E,3Z)-1-amino-4-methyl-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-6,7-dimethyl-1,9-dihydrocyclohepta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166085943 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-[(1E,3Z)-1-amino-4-methyl-3-[(Z)-prop-1-enyl]hexa-1,3,5-trien-2-yl]-6,7-dimethyl-1,9-dihydrocyclohepta[d]pyrimidine-2,4-dione |
| SMILES | C=C/C(C)=C(/C=C\C)C(=C/N)\n1c(=O)[nH]c2c(c1=O)C=C(C)C(C)=CC2 |
| InChI | InChI=1S/C21H25N3O2/c1-6-8-16(13(3)7-2)19(12-22)24-20(25)17-11-15(5)14(4)9-10-18(17)23-21(24)26/h6-9,11-12H,2,10,22H2,1,3-5H3,(H,23,26)/b8-6-,16-13-,19-12+ |
| InChIKey | PMYNOUGFFSBLMC-ZAXIUCKFSA-N |
| XLogP | 3.28 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|