C11H13NNiO3 — CID 166087011
[(2Z)-2-[(2S)-2-carboxypyrrolidine-1-carbonyl]penta-2,4-dienylidene]nickel (PubChem CID 166087011) has the molecular formula C11H13NNiO3 and a molecular weight of 265.92 g/mol. Its IUPAC name is [(2Z)-2-[(2S)-2-carboxypyrrolidine-1-carbonyl]penta-2,4-dienylidene]nickel.
| Compound Name | [(2Z)-2-[(2S)-2-carboxypyrrolidine-1-carbonyl]penta-2,4-dienylidene]nickel |
|---|---|
| PubChem CID | 166087011 |
| Molecular Formula | C11H13NNiO3 |
| Molecular Weight | 265.92 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | [(2Z)-2-[(2S)-2-carboxypyrrolidine-1-carbonyl]penta-2,4-dienylidene]nickel |
| SMILES | C=C/C=C(\C=[Ni])C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H13NO3.Ni/c1-3-5-8(2)10(13)12-7-4-6-9(12)11(14)15;/h2-3,5,9H,1,4,6-7H2,(H,14,15);/b8-5+;/t9-;/m0./s1 |
| InChIKey | FMDWAPWTZHWMGC-YIQAYKGESA-N |
| XLogP | 0.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.92 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|