C12H12BrN3O2 — CID 166088133
5-(bromomethyl)-N-(1-cyanocyclopropyl)-4-methoxypyridine-2-carboxamide (PubChem CID 166088133) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is 5-(bromomethyl)-N-(1-cyanocyclopropyl)-4-methoxypyridine-2-carboxamide.
| Compound Name | 5-(bromomethyl)-N-(1-cyanocyclopropyl)-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 166088133 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 5-(bromomethyl)-N-(1-cyanocyclopropyl)-4-methoxypyridine-2-carboxamide |
| SMILES | COc1cc(C(=O)NC2(C#N)CC2)ncc1CBr |
| InChI | InChI=1S/C12H12BrN3O2/c1-18-10-4-9(15-6-8(10)5-13)11(17)16-12(7-14)2-3-12/h4,6H,2-3,5H2,1H3,(H,16,17) |
| InChIKey | YRUMTPCSAFESAV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|