C14H25N3O3 — CID 171489496
ethane;4-methoxy-5-[(2-methoxyethylamino)methyl]-N-methylpyridine-2-carboxamide (PubChem CID 171489496) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is ethane;4-methoxy-5-[(2-methoxyethylamino)methyl]-N-methylpyridine-2-carboxamide.
| Compound Name | ethane;4-methoxy-5-[(2-methoxyethylamino)methyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 171489496 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | ethane;4-methoxy-5-[(2-methoxyethylamino)methyl]-N-methylpyridine-2-carboxamide |
| SMILES | CC.CNC(=O)c1cc(OC)c(CNCCOC)cn1 |
| InChI | InChI=1S/C12H19N3O3.C2H6/c1-13-12(16)10-6-11(18-3)9(8-15-10)7-14-4-5-17-2;1-2/h6,8,14H,4-5,7H2,1-3H3,(H,13,16);1-2H3 |
| InChIKey | HZBBAAOOZBJZRX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|