C10H14N2O3 — CID 153331814
5-[(2-hydroxyethylamino)methyl]-4-methoxypyridine-2-carbaldehyde (PubChem CID 153331814) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-[(2-hydroxyethylamino)methyl]-4-methoxypyridine-2-carbaldehyde.
| Compound Name | 5-[(2-hydroxyethylamino)methyl]-4-methoxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 153331814 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-[(2-hydroxyethylamino)methyl]-4-methoxypyridine-2-carbaldehyde |
| SMILES | COc1cc(C=O)ncc1CNCCO |
| InChI | InChI=1S/C10H14N2O3/c1-15-10-4-9(7-14)12-6-8(10)5-11-2-3-13/h4,6-7,11,13H,2-3,5H2,1H3 |
| InChIKey | IWCHBDZECWOBTC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|