C10H5BrF4N2OS — CID 166088349
2-[(6-bromo-3-fluoro-2-pyridinyl)oxymethyl]-5-(trifluoromethyl)-1,3-thiazole (PubChem CID 166088349) has the molecular formula C10H5BrF4N2OS and a molecular weight of 357.13 g/mol. Its IUPAC name is 2-[(6-bromo-3-fluoro-2-pyridinyl)oxymethyl]-5-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-[(6-bromo-3-fluoro-2-pyridinyl)oxymethyl]-5-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 166088349 |
| Molecular Formula | C10H5BrF4N2OS |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | 2-[(6-bromo-3-fluoro-2-pyridinyl)oxymethyl]-5-(trifluoromethyl)-1,3-thiazole |
| SMILES | Fc1ccc(Br)nc1OCc1ncc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H5BrF4N2OS/c11-7-2-1-5(12)9(17-7)18-4-8-16-3-6(19-8)10(13,14)15/h1-3H,4H2 |
| InChIKey | XPUUNFYUNKGOOV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|