C18H39N — CID 166088744
ethane;(Z)-N,5,5,7,7-pentamethylnon-2-en-4-imine (PubChem CID 166088744) has the molecular formula C18H39N and a molecular weight of 269.52 g/mol. Its IUPAC name is ethane;(Z)-N,5,5,7,7-pentamethylnon-2-en-4-imine.
| Compound Name | ethane;(Z)-N,5,5,7,7-pentamethylnon-2-en-4-imine |
|---|---|
| PubChem CID | 166088744 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | ethane;(Z)-N,5,5,7,7-pentamethylnon-2-en-4-imine |
| SMILES | C/C=C\C(=N/C)C(C)(C)CC(C)(C)CC.CC.CC |
| InChI | InChI=1S/C14H27N.2C2H6/c1-8-10-12(15-7)14(5,6)11-13(3,4)9-2;2*1-2/h8,10H,9,11H2,1-7H3;2*1-2H3/b10-8-,15-12+;; |
| InChIKey | BGXYQEDPXNNPBN-KDULCERBSA-N |
| XLogP | 6.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|