C17H28BNO3 — CID 166092394
1-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylethanamine (PubChem CID 166092394) has the molecular formula C17H28BNO3 and a molecular weight of 305.23 g/mol. Its IUPAC name is 1-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylethanamine.
| Compound Name | 1-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 166092394 |
| Molecular Formula | C17H28BNO3 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N,N-dimethylethanamine |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1C(C)N(C)C |
| InChI | InChI=1S/C17H28BNO3/c1-12(19(6)7)14-11-13(9-10-15(14)20-8)18-21-16(2,3)17(4,5)22-18/h9-12H,1-8H3 |
| InChIKey | AHBVBFXLDQFEKT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|