C16H11BrFN3OS — CID 166093942
2-bromo-3-fluoro-10-methyl-5-sulfanyl-6,9-dihydroisoquinolino[7,6-c][1,8]naphthyridin-8-one (PubChem CID 166093942) has the molecular formula C16H11BrFN3OS and a molecular weight of 392.25 g/mol. Its IUPAC name is 2-bromo-3-fluoro-10-methyl-5-sulfanyl-6,9-dihydroisoquinolino[7,6-c][1,8]naphthyridin-8-one.
| Compound Name | 2-bromo-3-fluoro-10-methyl-5-sulfanyl-6,9-dihydroisoquinolino[7,6-c][1,8]naphthyridin-8-one |
|---|---|
| PubChem CID | 166093942 |
| Molecular Formula | C16H11BrFN3OS |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2-bromo-3-fluoro-10-methyl-5-sulfanyl-6,9-dihydroisoquinolino[7,6-c][1,8]naphthyridin-8-one |
| SMILES | Cc1cc2cc3c(cc2c(=O)[nH]1)CN(S)c1nc(F)c(Br)cc1-3 |
| InChI | InChI=1S/C16H11BrFN3OS/c1-7-2-8-3-10-9(4-11(8)16(22)19-7)6-21(23)15-12(10)5-13(17)14(18)20-15/h2-5,23H,6H2,1H3,(H,19,22) |
| InChIKey | BWAPQUKTLYTSNE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|