C15H10BrF2N3O — CID 166094580
6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-7-fluoro-3-methyl-2H-isoquinolin-1-one (PubChem CID 166094580) has the molecular formula C15H10BrF2N3O and a molecular weight of 366.17 g/mol. Its IUPAC name is 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-7-fluoro-3-methyl-2H-isoquinolin-1-one.
| Compound Name | 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-7-fluoro-3-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166094580 |
| Molecular Formula | C15H10BrF2N3O |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 6-(2-amino-5-bromo-6-fluoro-3-pyridinyl)-7-fluoro-3-methyl-2H-isoquinolin-1-one |
| SMILES | Cc1cc2cc(-c3cc(Br)c(F)nc3N)c(F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H10BrF2N3O/c1-6-2-7-3-9(12(17)5-8(7)15(22)20-6)10-4-11(16)13(18)21-14(10)19/h2-5H,1H3,(H2,19,21)(H,20,22) |
| InChIKey | VYXOJOBJDDIMPA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|