C19H24ClFN4 — CID 166093964
3-chloro-6-fluoro-5-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]phenyl]pyridin-2-amine (PubChem CID 166093964) has the molecular formula C19H24ClFN4 and a molecular weight of 362.88 g/mol. Its IUPAC name is 3-chloro-6-fluoro-5-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]phenyl]pyridin-2-amine.
| Compound Name | 3-chloro-6-fluoro-5-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 166093964 |
| Molecular Formula | C19H24ClFN4 |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-chloro-6-fluoro-5-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]phenyl]pyridin-2-amine |
| SMILES | CC(C)[C@@H]1CN(c2ccc(-c3cc(Cl)c(N)nc3F)cc2)CCN1C |
| InChI | InChI=1S/C19H24ClFN4/c1-12(2)17-11-25(9-8-24(17)3)14-6-4-13(5-7-14)15-10-16(20)19(22)23-18(15)21/h4-7,10,12,17H,8-9,11H2,1-3H3,(H2,22,23)/t17-/m0/s1 |
| InChIKey | OWJXOMXYSZGZOB-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|