C18H20ClF2N3O — CID 166094685
3-chloro-6-fluoro-5-[2-fluoro-4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]pyridin-2-amine (PubChem CID 166094685) has the molecular formula C18H20ClF2N3O and a molecular weight of 367.83 g/mol. Its IUPAC name is 3-chloro-6-fluoro-5-[2-fluoro-4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]pyridin-2-amine.
| Compound Name | 3-chloro-6-fluoro-5-[2-fluoro-4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 166094685 |
| Molecular Formula | C18H20ClF2N3O |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-chloro-6-fluoro-5-[2-fluoro-4-[(2R)-2-propan-2-ylmorpholin-4-yl]phenyl]pyridin-2-amine |
| SMILES | CC(C)[C@@H]1CN(c2ccc(-c3cc(Cl)c(N)nc3F)c(F)c2)CCO1 |
| InChI | InChI=1S/C18H20ClF2N3O/c1-10(2)16-9-24(5-6-25-16)11-3-4-12(15(20)7-11)13-8-14(19)18(22)23-17(13)21/h3-4,7-8,10,16H,5-6,9H2,1-2H3,(H2,22,23)/t16-/m0/s1 |
| InChIKey | UWYFFFISVJNZCL-INIZCTEOSA-N |
| XLogP | 4.12 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|