C17H21ClN4O — CID 174213938
3-chloro-5-[4-(2-propan-2-ylmorpholin-4-yl)phenyl]pyrazin-2-amine (PubChem CID 174213938) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 3-chloro-5-[4-(2-propan-2-ylmorpholin-4-yl)phenyl]pyrazin-2-amine.
| Compound Name | 3-chloro-5-[4-(2-propan-2-ylmorpholin-4-yl)phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 174213938 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-chloro-5-[4-(2-propan-2-ylmorpholin-4-yl)phenyl]pyrazin-2-amine |
| SMILES | CC(C)C1CN(c2ccc(-c3cnc(N)c(Cl)n3)cc2)CCO1 |
| InChI | InChI=1S/C17H21ClN4O/c1-11(2)15-10-22(7-8-23-15)13-5-3-12(4-6-13)14-9-20-17(19)16(18)21-14/h3-6,9,11,15H,7-8,10H2,1-2H3,(H2,19,20) |
| InChIKey | UKVMUMSJSOWKEH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |