C26H25F2N5 — CID 166093555
6-fluoro-3-(8-fluoro-1-methylidene-2H-isoquinolin-6-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine (PubChem CID 166093555) has the molecular formula C26H25F2N5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 6-fluoro-3-(8-fluoro-1-methylidene-2H-isoquinolin-6-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine.
| Compound Name | 6-fluoro-3-(8-fluoro-1-methylidene-2H-isoquinolin-6-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 166093555 |
| Molecular Formula | C26H25F2N5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 6-fluoro-3-(8-fluoro-1-methylidene-2H-isoquinolin-6-yl)-5-[4-(4-methylpiperazin-1-yl)phenyl]pyridin-2-amine |
| SMILES | C=C1NC=Cc2cc(-c3cc(-c4ccc(N5CCN(C)CC5)cc4)c(F)nc3N)cc(F)c21 |
| InChI | InChI=1S/C26H25F2N5/c1-16-24-18(7-8-30-16)13-19(14-23(24)27)22-15-21(25(28)31-26(22)29)17-3-5-20(6-4-17)33-11-9-32(2)10-12-33/h3-8,13-15,30H,1,9-12H2,2H3,(H2,29,31) |
| InChIKey | NITOIRVKJJRJKR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|