C27H26F3N5O — CID 166093834
6-[2-amino-5-[4-(4-ethylpiperazin-1-yl)phenyl]-6-fluoro-3-pyridinyl]-4,8-difluoro-3-methyl-2H-isoquinolin-1-one (PubChem CID 166093834) has the molecular formula C27H26F3N5O and a molecular weight of 493.53 g/mol. Its IUPAC name is 6-[2-amino-5-[4-(4-ethylpiperazin-1-yl)phenyl]-6-fluoro-3-pyridinyl]-4,8-difluoro-3-methyl-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-5-[4-(4-ethylpiperazin-1-yl)phenyl]-6-fluoro-3-pyridinyl]-4,8-difluoro-3-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166093834 |
| Molecular Formula | C27H26F3N5O |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 6-[2-amino-5-[4-(4-ethylpiperazin-1-yl)phenyl]-6-fluoro-3-pyridinyl]-4,8-difluoro-3-methyl-2H-isoquinolin-1-one |
| SMILES | CCN1CCN(c2ccc(-c3cc(-c4cc(F)c5c(=O)[nH]c(C)c(F)c5c4)c(N)nc3F)cc2)CC1 |
| InChI | InChI=1S/C27H26F3N5O/c1-3-34-8-10-35(11-9-34)18-6-4-16(5-7-18)19-14-20(26(31)33-25(19)30)17-12-21-23(22(28)13-17)27(36)32-15(2)24(21)29/h4-7,12-14H,3,8-11H2,1-2H3,(H2,31,33)(H,32,36) |
| InChIKey | IUGKQKPSJYJZKK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|