C27H27F2N5O2 — CID 166094083
6-[2-amino-5-[3-[(dimethylamino)methyl]-4-morpholin-4-ylphenyl]-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one (PubChem CID 166094083) has the molecular formula C27H27F2N5O2 and a molecular weight of 491.54 g/mol. Its IUPAC name is 6-[2-amino-5-[3-[(dimethylamino)methyl]-4-morpholin-4-ylphenyl]-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-5-[3-[(dimethylamino)methyl]-4-morpholin-4-ylphenyl]-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166094083 |
| Molecular Formula | C27H27F2N5O2 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 6-[2-amino-5-[3-[(dimethylamino)methyl]-4-morpholin-4-ylphenyl]-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one |
| SMILES | CN(C)Cc1cc(-c2cc(-c3ccc4c(=O)[nH]cc(F)c4c3)c(N)nc2F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C27H27F2N5O2/c1-33(2)15-18-11-16(4-6-24(18)34-7-9-36-10-8-34)20-13-21(26(30)32-25(20)29)17-3-5-19-22(12-17)23(28)14-31-27(19)35/h3-6,11-14H,7-10,15H2,1-2H3,(H2,30,32)(H,31,35) |
| InChIKey | NBGRQFVRAUOFKF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|