C23H17F2N3O2 — CID 166093854
6-[2-amino-5-(3,4-dihydro-2H-chromen-6-yl)-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one (PubChem CID 166093854) has the molecular formula C23H17F2N3O2 and a molecular weight of 405.40 g/mol. Its IUPAC name is 6-[2-amino-5-(3,4-dihydro-2H-chromen-6-yl)-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-5-(3,4-dihydro-2H-chromen-6-yl)-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166093854 |
| Molecular Formula | C23H17F2N3O2 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 6-[2-amino-5-(3,4-dihydro-2H-chromen-6-yl)-6-fluoro-3-pyridinyl]-4-fluoro-2H-isoquinolin-1-one |
| SMILES | Nc1nc(F)c(-c2ccc3c(c2)CCCO3)cc1-c1ccc2c(=O)[nH]cc(F)c2c1 |
| InChI | InChI=1S/C23H17F2N3O2/c24-19-11-27-23(29)15-5-3-13(9-18(15)19)17-10-16(21(25)28-22(17)26)12-4-6-20-14(8-12)2-1-7-30-20/h3-6,8-11H,1-2,7H2,(H2,26,28)(H,27,29) |
| InChIKey | KRJUOOVGZHXUQX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|