C24H22F2N4O — CID 166093908
6-[2-amino-5-[3-[(dimethylamino)methyl]-4-fluorophenyl]-6-fluoro-3-pyridinyl]-4-methyl-2H-isoquinolin-1-one (PubChem CID 166093908) has the molecular formula C24H22F2N4O and a molecular weight of 420.46 g/mol. Its IUPAC name is 6-[2-amino-5-[3-[(dimethylamino)methyl]-4-fluorophenyl]-6-fluoro-3-pyridinyl]-4-methyl-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-5-[3-[(dimethylamino)methyl]-4-fluorophenyl]-6-fluoro-3-pyridinyl]-4-methyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166093908 |
| Molecular Formula | C24H22F2N4O |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 6-[2-amino-5-[3-[(dimethylamino)methyl]-4-fluorophenyl]-6-fluoro-3-pyridinyl]-4-methyl-2H-isoquinolin-1-one |
| SMILES | Cc1c[nH]c(=O)c2ccc(-c3cc(-c4ccc(F)c(CN(C)C)c4)c(F)nc3N)cc12 |
| InChI | InChI=1S/C24H22F2N4O/c1-13-11-28-24(31)17-6-4-15(9-18(13)17)20-10-19(22(26)29-23(20)27)14-5-7-21(25)16(8-14)12-30(2)3/h4-11H,12H2,1-3H3,(H2,27,29)(H,28,31) |
| InChIKey | FXWUJNHUJCEOTE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|