C18H16ClFN2O — CID 167823138
8-chloro-4-[4-[(dimethylamino)methyl]-3-fluorophenyl]-2H-isoquinolin-1-one (PubChem CID 167823138) has the molecular formula C18H16ClFN2O and a molecular weight of 330.79 g/mol. Its IUPAC name is 8-chloro-4-[4-[(dimethylamino)methyl]-3-fluorophenyl]-2H-isoquinolin-1-one.
| Compound Name | 8-chloro-4-[4-[(dimethylamino)methyl]-3-fluorophenyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 167823138 |
| Molecular Formula | C18H16ClFN2O |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 8-chloro-4-[4-[(dimethylamino)methyl]-3-fluorophenyl]-2H-isoquinolin-1-one |
| SMILES | CN(C)Cc1ccc(-c2c[nH]c(=O)c3c(Cl)cccc23)cc1F |
| InChI | InChI=1S/C18H16ClFN2O/c1-22(2)10-12-7-6-11(8-16(12)20)14-9-21-18(23)17-13(14)4-3-5-15(17)19/h3-9H,10H2,1-2H3,(H,21,23) |
| InChIKey | SSVRHDNOLWAWLH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |