C17H17FN2 — CID 46312766
1-[4-(4-fluorophenyl)-1H-indol-3-yl]-N,N-dimethylmethanamine (PubChem CID 46312766) has the molecular formula C17H17FN2 and a molecular weight of 268.34 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-1H-indol-3-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-(4-fluorophenyl)-1H-indol-3-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 46312766 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-1H-indol-3-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1c[nH]c2cccc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C17H17FN2/c1-20(2)11-13-10-19-16-5-3-4-15(17(13)16)12-6-8-14(18)9-7-12/h3-10,19H,11H2,1-2H3 |
| InChIKey | SYDCPBIUXDKVOG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |