C26H25F2N5O — CID 166093946
7-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-5-fluoro-2-methyl-3H-quinazolin-4-one;3-methyl-3-azabicyclo[3.1.0]hexane (PubChem CID 166093946) has the molecular formula C26H25F2N5O and a molecular weight of 461.52 g/mol. Its IUPAC name is 7-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-5-fluoro-2-methyl-3H-quinazolin-4-one;3-methyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 7-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-5-fluoro-2-methyl-3H-quinazolin-4-one;3-methyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 166093946 |
| Molecular Formula | C26H25F2N5O |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 7-(2-amino-6-fluoro-5-phenyl-3-pyridinyl)-5-fluoro-2-methyl-3H-quinazolin-4-one;3-methyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CN1CC2CC2C1.Cc1nc2cc(-c3cc(-c4ccccc4)c(F)nc3N)cc(F)c2c(=O)[nH]1 |
| InChI | InChI=1S/C20H14F2N4O.C6H11N/c1-10-24-16-8-12(7-15(21)17(16)20(27)25-10)14-9-13(18(22)26-19(14)23)11-5-3-2-4-6-11;1-7-3-5-2-6(5)4-7/h2-9H,1H3,(H2,23,26)(H,24,25,27);5-6H,2-4H2,1H3 |
| InChIKey | ZWKLDGVRCUKOLB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|