C28H30FN5 — CID 166093623
5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine (PubChem CID 166093623) has the molecular formula C28H30FN5 and a molecular weight of 455.58 g/mol. Its IUPAC name is 5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine.
| Compound Name | 5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 166093623 |
| Molecular Formula | C28H30FN5 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 5-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)phenyl]-6-fluoro-3-(1-methylidene-3,4-dihydro-2H-isoquinolin-6-yl)pyridin-2-amine |
| SMILES | C=C1NCCc2cc(-c3cc(-c4ccc(N5CCN6CCCC6C5)cc4)c(F)nc3N)ccc21 |
| InChI | InChI=1S/C28H30FN5/c1-18-24-9-6-20(15-21(24)10-11-31-18)26-16-25(27(29)32-28(26)30)19-4-7-22(8-5-19)34-14-13-33-12-2-3-23(33)17-34/h4-9,15-16,23,31H,1-3,10-14,17H2,(H2,30,32) |
| InChIKey | UOHRPMINIYFPPG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|