C26H27FN4O2 — CID 166094658
6-[2-amino-6-fluoro-5-[4-[(3R)-piperidin-3-yl]oxyphenyl]-3-pyridinyl]-7-methyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166094658) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 6-[2-amino-6-fluoro-5-[4-[(3R)-piperidin-3-yl]oxyphenyl]-3-pyridinyl]-7-methyl-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-6-fluoro-5-[4-[(3R)-piperidin-3-yl]oxyphenyl]-3-pyridinyl]-7-methyl-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166094658 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 6-[2-amino-6-fluoro-5-[4-[(3R)-piperidin-3-yl]oxyphenyl]-3-pyridinyl]-7-methyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | Cc1cc2c(cc1-c1cc(-c3ccc(O[C@@H]4CCCNC4)cc3)c(F)nc1N)CCNC2=O |
| InChI | InChI=1S/C26H27FN4O2/c1-15-11-22-17(8-10-30-26(22)32)12-20(15)23-13-21(24(27)31-25(23)28)16-4-6-18(7-5-16)33-19-3-2-9-29-14-19/h4-7,11-13,19,29H,2-3,8-10,14H2,1H3,(H2,28,31)(H,30,32)/t19-/m1/s1 |
| InChIKey | IWEQUCRNQNCJFC-LJQANCHMSA-N |
| XLogP | 3.86 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|