C22H24N4O2 — CID 16609575
1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-4-(4-methylphenoxy)butan-1-one (PubChem CID 16609575) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-4-(4-methylphenoxy)butan-1-one.
| Compound Name | 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-4-(4-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 16609575 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-4-(4-methylphenoxy)butan-1-one |
| SMILES | Cc1ccc(OCCCC(=O)N2CCN(C)c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-16-9-11-17(12-10-16)28-15-5-8-20(27)26-14-13-25(2)21-22(26)24-19-7-4-3-6-18(19)23-21/h3-4,6-7,9-12H,5,8,13-15H2,1-2H3 |
| InChIKey | VDUUZJLXFBERHP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|