About (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone
(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone (PubChem CID 18153299) has the molecular formula C18H17N5O
and a molecular weight of 319.37 g/mol. Its IUPAC name is (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone.
Molecular Properties
| Compound Name | (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone |
| PubChem CID | 18153299 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C)c3nc4ccccc4nc32)cn1 |
| InChI | InChI=1S/C18H17N5O/c1-12-7-8-13(11-19-12)18(24)23-10-9-22(2)16-17(23)21-15-6-4-3-5-14(15)20-16/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | XSYLZARODMJHFX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone?
The IUPAC name of (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone (CID 18153299) is (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone.
What is the SMILES notation for (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone?
The canonical SMILES for (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone is Cc1ccc(C(=O)N2CCN(C)c3nc4ccccc4nc32)cn1.
What is the InChIKey of (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone?
The InChIKey is XSYLZARODMJHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O/c1-12-7-8-13(11-19-12)18(24)23-10-9-22(2)16-17(23)21-15-6-4-3-5-14(15)20-16/h3-8,11H,9-10H2,1-2H3.
What are the key properties of (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone?
(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone has a molecular weight of 319.37 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-(6-methyl-3-pyridinyl)methanone is sourced from PubChem (CID 18153299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).