C19H13F5N4O — CID 16609634
1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone (PubChem CID 16609634) has the molecular formula C19H13F5N4O and a molecular weight of 408.33 g/mol. Its IUPAC name is 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone.
| Compound Name | 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone |
|---|---|
| PubChem CID | 16609634 |
| Molecular Formula | C19H13F5N4O |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2,3,4,5,6-pentafluorophenyl)ethanone |
| SMILES | CN1CCN(C(=O)Cc2c(F)c(F)c(F)c(F)c2F)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H13F5N4O/c1-27-6-7-28(19-18(27)25-10-4-2-3-5-11(10)26-19)12(29)8-9-13(20)15(22)17(24)16(23)14(9)21/h2-5H,6-8H2,1H3 |
| InChIKey | ZVMMCAREJCNLKL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|