C19H17N5O4 — CID 18153257
1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2-nitrophenoxy)ethanone (PubChem CID 18153257) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 18153257 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)-2-(2-nitrophenoxy)ethanone |
| SMILES | CN1CCN(C(=O)COc2ccccc2[N+](=O)[O-])c2nc3ccccc3nc21 |
| InChI | InChI=1S/C19H17N5O4/c1-22-10-11-23(19-18(22)20-13-6-2-3-7-14(13)21-19)17(25)12-28-16-9-5-4-8-15(16)24(26)27/h2-9H,10-12H2,1H3 |
| InChIKey | MPHSLFJMIOYPTN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|