C19H20N4O7 — CID 3755477
1-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-2-(2-nitrophenoxy)ethanone (PubChem CID 3755477) has the molecular formula C19H20N4O7 and a molecular weight of 416.39 g/mol. Its IUPAC name is 1-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 3755477 |
| Molecular Formula | C19H20N4O7 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-2-(2-nitrophenoxy)ethanone |
| SMILES | COc1ccc(C(=O)N2CCCN2C(=O)COc2ccccc2[N+](=O)[O-])c(OC)n1 |
| InChI | InChI=1S/C19H20N4O7/c1-28-16-9-8-13(18(20-16)29-2)19(25)22-11-5-10-21(22)17(24)12-30-15-7-4-3-6-14(15)23(26)27/h3-4,6-9H,5,10-12H2,1-2H3 |
| InChIKey | WIRSUWXNJNHPBC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 124.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|