C26H27N7O2 — CID 166099368
2-methyl-3-[3-[2-[1-(oxan-2-yl)-5-propan-2-yloxyindazol-3-yl]pyrimidin-4-yl]pyrazol-1-yl]prop-2-enenitrile (PubChem CID 166099368) has the molecular formula C26H27N7O2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-methyl-3-[3-[2-[1-(oxan-2-yl)-5-propan-2-yloxyindazol-3-yl]pyrimidin-4-yl]pyrazol-1-yl]prop-2-enenitrile.
| Compound Name | 2-methyl-3-[3-[2-[1-(oxan-2-yl)-5-propan-2-yloxyindazol-3-yl]pyrimidin-4-yl]pyrazol-1-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 166099368 |
| Molecular Formula | C26H27N7O2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2-methyl-3-[3-[2-[1-(oxan-2-yl)-5-propan-2-yloxyindazol-3-yl]pyrimidin-4-yl]pyrazol-1-yl]prop-2-enenitrile |
| SMILES | CC(C#N)=Cn1ccc(-c2ccnc(-c3nn(C4CCCCO4)c4ccc(OC(C)C)cc34)n2)n1 |
| InChI | InChI=1S/C26H27N7O2/c1-17(2)35-19-7-8-23-20(14-19)25(31-33(23)24-6-4-5-13-34-24)26-28-11-9-21(29-26)22-10-12-32(30-22)16-18(3)15-27/h7-12,14,16-17,24H,4-6,13H2,1-3H3 |
| InChIKey | PFBFEWXJUXENAU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 103.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|