C34H36F3N5O2 — CID 166102758
4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol (PubChem CID 166102758) has the molecular formula C34H36F3N5O2 and a molecular weight of 603.69 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 166102758 |
| Molecular Formula | C34H36F3N5O2 |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-8-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-7-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
| SMILES | CCc1c(F)ccc2cc(O)cc(-c3c(F)cc4c(N5C6CCC5CNC6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C34H36F3N5O2/c1-2-23-26(35)8-5-19-13-22(43)14-24(28(19)23)29-27(36)15-25-31(30(29)37)39-33(44-18-34-9-3-11-41(34)12-4-10-34)40-32(25)42-20-6-7-21(42)17-38-16-20/h5,8,13-15,20-21,38,43H,2-4,6-7,9-12,16-18H2,1H3 |
| InChIKey | YIOVUYYYGDCPKJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |