C32H35F2N7O2 — CID 167241401
4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-4-fluoro-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimido[5,4-c]pyridazin-3-yl]-5-ethyl-6-fluoronaphthalen-2-ol (PubChem CID 167241401) has the molecular formula C32H35F2N7O2 and a molecular weight of 587.68 g/mol. Its IUPAC name is 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-4-fluoro-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimido[5,4-c]pyridazin-3-yl]-5-ethyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-4-fluoro-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimido[5,4-c]pyridazin-3-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 167241401 |
| Molecular Formula | C32H35F2N7O2 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 4-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-4-fluoro-6-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrimido[5,4-c]pyridazin-3-yl]-5-ethyl-6-fluoronaphthalen-2-ol |
| SMILES | CCc1c(F)ccc2cc(O)cc(-c3nnc4c(N5CC6CCC(C5)N6)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C32H35F2N7O2/c1-2-22-24(33)8-5-18-13-21(42)14-23(25(18)22)27-26(34)28-29(39-38-27)30(40-15-19-6-7-20(16-40)35-19)37-31(36-28)43-17-32-9-3-11-41(32)12-4-10-32/h5,8,13-14,19-20,35,42H,2-4,6-7,9-12,15-17H2,1H3 |
| InChIKey | YETABUAHHZISRF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |