C35H43F3N6O2 — CID 176661096
ethane;5-ethyl-4-[5-ethyl-8-fluoro-4-(3-fluoropiperazin-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-6-fluoronaphthalen-2-ol (PubChem CID 176661096) has the molecular formula C35H43F3N6O2 and a molecular weight of 636.76 g/mol. Its IUPAC name is ethane;5-ethyl-4-[5-ethyl-8-fluoro-4-(3-fluoropiperazin-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-6-fluoronaphthalen-2-ol.
| Compound Name | ethane;5-ethyl-4-[5-ethyl-8-fluoro-4-(3-fluoropiperazin-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 176661096 |
| Molecular Formula | C35H43F3N6O2 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | ethane;5-ethyl-4-[5-ethyl-8-fluoro-4-(3-fluoropiperazin-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-6-fluoronaphthalen-2-ol |
| SMILES | CC.CCc1c(F)ccc2cc(O)cc(-c3nc(CC)c4c(N5CCNC(F)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H37F3N6O2.C2H6/c1-3-21-23(34)8-7-19-15-20(43)16-22(26(19)21)29-28(36)30-27(24(4-2)38-29)31(41-14-11-37-25(35)17-41)40-32(39-30)44-18-33-9-5-12-42(33)13-6-10-33;1-2/h7-8,15-16,25,37,43H,3-6,9-14,17-18H2,1-2H3;1-2H3 |
| InChIKey | YNVRANRCXQZHLZ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|