C33H32F4N6O2 — CID 176660957
4-[4-(3,5-difluoropiperazin-1-yl)-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 176660957) has the molecular formula C33H32F4N6O2 and a molecular weight of 620.65 g/mol. Its IUPAC name is 4-[4-(3,5-difluoropiperazin-1-yl)-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-(3,5-difluoropiperazin-1-yl)-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 176660957 |
| Molecular Formula | C33H32F4N6O2 |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 4-[4-(3,5-difluoropiperazin-1-yl)-5-ethyl-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3nc(CC)c4c(N5CC(F)NC(F)C5)nc(OCC56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C33H32F4N6O2/c1-3-20-22(34)8-7-18-13-19(44)14-21(26(18)20)29-28(37)30-27(23(4-2)38-29)31(42-15-24(35)39-25(36)16-42)41-32(40-30)45-17-33-9-5-11-43(33)12-6-10-33/h1,7-8,13-14,24-25,39,44H,4-6,9-12,15-17H2,2H3 |
| InChIKey | SJCMIJSWNMPWMW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|