C10H20N2S — CID 166103059
ethane;2-[(3R)-piperidin-3-yl]-2,3-dihydro-1,3-thiazole (PubChem CID 166103059) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is ethane;2-[(3R)-piperidin-3-yl]-2,3-dihydro-1,3-thiazole.
| Compound Name | ethane;2-[(3R)-piperidin-3-yl]-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 166103059 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | ethane;2-[(3R)-piperidin-3-yl]-2,3-dihydro-1,3-thiazole |
| SMILES | C1=CSC([C@@H]2CCCNC2)N1.CC |
| InChI | InChI=1S/C8H14N2S.C2H6/c1-2-7(6-9-3-1)8-10-4-5-11-8;1-2/h4-5,7-10H,1-3,6H2;1-2H3/t7-,8?;/m1./s1 |
| InChIKey | HRACPHHROIYHIY-PGMKYVDRSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |