C15H21N3O2S — CID 16610321
4-[(6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid (PubChem CID 16610321) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[(6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 4-[(6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 16610321 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[(6-ethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid |
| SMILES | CCc1cc2c(NCCCC(=O)O)nc(C(C)C)nc2s1 |
| InChI | InChI=1S/C15H21N3O2S/c1-4-10-8-11-14(16-7-5-6-12(19)20)17-13(9(2)3)18-15(11)21-10/h8-9H,4-7H2,1-3H3,(H,19,20)(H,16,17,18) |
| InChIKey | YZXFHZJZPKDZNR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|