C22H24F3N3O2 — CID 166104926
1H-indol-6-yl-(3-methylpiperidin-1-yl)methanone;3-methoxy-2-(trifluoromethyl)pyridine (PubChem CID 166104926) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 1H-indol-6-yl-(3-methylpiperidin-1-yl)methanone;3-methoxy-2-(trifluoromethyl)pyridine.
| Compound Name | 1H-indol-6-yl-(3-methylpiperidin-1-yl)methanone;3-methoxy-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 166104926 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1H-indol-6-yl-(3-methylpiperidin-1-yl)methanone;3-methoxy-2-(trifluoromethyl)pyridine |
| SMILES | CC1CCCN(C(=O)c2ccc3cc[nH]c3c2)C1.COc1cccnc1C(F)(F)F |
| InChI | InChI=1S/C15H18N2O.C7H6F3NO/c1-11-3-2-8-17(10-11)15(18)13-5-4-12-6-7-16-14(12)9-13;1-12-5-3-2-4-11-6(5)7(8,9)10/h4-7,9,11,16H,2-3,8,10H2,1H3;2-4H,1H3 |
| InChIKey | VEOFVPJVIACEPA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |