C13H27N — CID 166105485
N-[(E)-3,4-dimethylpent-2-en-2-yl]butan-2-imine;ethane (PubChem CID 166105485) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N-[(E)-3,4-dimethylpent-2-en-2-yl]butan-2-imine;ethane.
| Compound Name | N-[(E)-3,4-dimethylpent-2-en-2-yl]butan-2-imine;ethane |
|---|---|
| PubChem CID | 166105485 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-[(E)-3,4-dimethylpent-2-en-2-yl]butan-2-imine;ethane |
| SMILES | CC.CC/C(C)=N/C(C)=C(\C)C(C)C |
| InChI | InChI=1S/C11H21N.C2H6/c1-7-9(4)12-11(6)10(5)8(2)3;1-2/h8H,7H2,1-6H3;1-2H3/b11-10+,12-9+; |
| InChIKey | HGJHCMBHSSADKM-DRNIDGBXSA-N |
| XLogP | 4.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|