C12H17N — CID 166106752
(6E)-N-methyl-6-(3-methylbutan-2-ylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 166106752) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (6E)-N-methyl-6-(3-methylbutan-2-ylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-N-methyl-6-(3-methylbutan-2-ylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 166106752 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (6E)-N-methyl-6-(3-methylbutan-2-ylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | C/N=C1\C=CC=C\C1=C(\C)C(C)C |
| InChI | InChI=1S/C12H17N/c1-9(2)10(3)11-7-5-6-8-12(11)13-4/h5-9H,1-4H3/b11-10+,13-12+ |
| InChIKey | RISJOWXKNTVYDS-AQASXUMVSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|