C23H27N5OS — CID 16610716
2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-(1-benzylpiperidin-4-yl)acetamide (PubChem CID 16610716) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-(1-benzylpiperidin-4-yl)acetamide.
| Compound Name | 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-(1-benzylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 16610716 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-(1-benzylpiperidin-4-yl)acetamide |
| SMILES | Nn1cc(-c2ccccc2)nc1SCC(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H27N5OS/c24-28-16-21(19-9-5-2-6-10-19)26-23(28)30-17-22(29)25-20-11-13-27(14-12-20)15-18-7-3-1-4-8-18/h1-10,16,20H,11-15,17,24H2,(H,25,29) |
| InChIKey | YNATZEOBAWRUHF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |