C27H25N3OS — CID 18269176
2-(1-benzyl-4,5-diphenylimidazol-2-yl)sulfanyl-N-cyclopropylacetamide (PubChem CID 18269176) has the molecular formula C27H25N3OS and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-(1-benzyl-4,5-diphenylimidazol-2-yl)sulfanyl-N-cyclopropylacetamide.
| Compound Name | 2-(1-benzyl-4,5-diphenylimidazol-2-yl)sulfanyl-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 18269176 |
| Molecular Formula | C27H25N3OS |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-(1-benzyl-4,5-diphenylimidazol-2-yl)sulfanyl-N-cyclopropylacetamide |
| SMILES | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)n1Cc1ccccc1)NC1CC1 |
| InChI | InChI=1S/C27H25N3OS/c31-24(28-23-16-17-23)19-32-27-29-25(21-12-6-2-7-13-21)26(22-14-8-3-9-15-22)30(27)18-20-10-4-1-5-11-20/h1-15,23H,16-19H2,(H,28,31) |
| InChIKey | VESYFIXVVVUDRV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |