C23H32N2O3 — CID 166107392
(6S,7R,10S)-10-ethenyl-7-[(4-phenylcyclohexyl)oxymethyl]-4-oxa-1,8-diazaspiro[5.5]undecan-2-one (PubChem CID 166107392) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is (6S,7R,10S)-10-ethenyl-7-[(4-phenylcyclohexyl)oxymethyl]-4-oxa-1,8-diazaspiro[5.5]undecan-2-one.
| Compound Name | (6S,7R,10S)-10-ethenyl-7-[(4-phenylcyclohexyl)oxymethyl]-4-oxa-1,8-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 166107392 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (6S,7R,10S)-10-ethenyl-7-[(4-phenylcyclohexyl)oxymethyl]-4-oxa-1,8-diazaspiro[5.5]undecan-2-one |
| SMILES | C=C[C@H]1CN[C@@H](COC2CCC(c3ccccc3)CC2)[C@]2(COCC(=O)N2)C1 |
| InChI | InChI=1S/C23H32N2O3/c1-2-17-12-23(16-27-15-22(26)25-23)21(24-13-17)14-28-20-10-8-19(9-11-20)18-6-4-3-5-7-18/h2-7,17,19-21,24H,1,8-16H2,(H,25,26)/t17-,19?,20?,21+,23-/m1/s1 |
| InChIKey | QJINYRJPKSXVJI-ATLMERFHSA-N |
| XLogP | 2.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|