C17H22BrFN2O3 — CID 166107547
tert-butyl (3E)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-4-methylpyrrolidine-1-carboxylate (PubChem CID 166107547) has the molecular formula C17H22BrFN2O3 and a molecular weight of 401.28 g/mol. Its IUPAC name is tert-butyl (3E)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166107547 |
| Molecular Formula | C17H22BrFN2O3 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | tert-butyl (3E)-2-[(3-bromo-2-fluorophenyl)methyl]-3-hydroxyimino-4-methylpyrrolidine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)C(Cc2cccc(Br)c2F)/C1=N/O |
| InChI | InChI=1S/C17H22BrFN2O3/c1-10-9-21(16(22)24-17(2,3)4)13(15(10)20-23)8-11-6-5-7-12(18)14(11)19/h5-7,10,13,23H,8-9H2,1-4H3/b20-15+ |
| InChIKey | NDTFDVSQCLLURO-HMMYKYKNSA-N |
| XLogP | 4.22 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|