C16H15ClFNO2 — CID 166110225
(3R)-3-[4-chloro-3-[(3-fluorophenyl)methoxy]phenyl]-1,2-oxazolidine (PubChem CID 166110225) has the molecular formula C16H15ClFNO2 and a molecular weight of 307.75 g/mol. Its IUPAC name is (3R)-3-[4-chloro-3-[(3-fluorophenyl)methoxy]phenyl]-1,2-oxazolidine.
| Compound Name | (3R)-3-[4-chloro-3-[(3-fluorophenyl)methoxy]phenyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 166110225 |
| Molecular Formula | C16H15ClFNO2 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (3R)-3-[4-chloro-3-[(3-fluorophenyl)methoxy]phenyl]-1,2-oxazolidine |
| SMILES | Fc1cccc(COc2cc([C@H]3CCON3)ccc2Cl)c1 |
| InChI | InChI=1S/C16H15ClFNO2/c17-14-5-4-12(15-6-7-21-19-15)9-16(14)20-10-11-2-1-3-13(18)8-11/h1-5,8-9,15,19H,6-7,10H2/t15-/m1/s1 |
| InChIKey | JZURHSIKKAOVIV-OAHLLOKOSA-N |
| XLogP | 4.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |