C32H31N2O4P — CID 166111427
2-[1-[3,6-dimethyl-2-(3-methylphenyl)-4-oxochromen-8-yl]ethylamino]benzoic acid;(Z)-2-(phosphanylidenemethyl)but-2-enenitrile (PubChem CID 166111427) has the molecular formula C32H31N2O4P and a molecular weight of 538.58 g/mol. Its IUPAC name is 2-[1-[3,6-dimethyl-2-(3-methylphenyl)-4-oxochromen-8-yl]ethylamino]benzoic acid;(Z)-2-(phosphanylidenemethyl)but-2-enenitrile.
| Compound Name | 2-[1-[3,6-dimethyl-2-(3-methylphenyl)-4-oxochromen-8-yl]ethylamino]benzoic acid;(Z)-2-(phosphanylidenemethyl)but-2-enenitrile |
|---|---|
| PubChem CID | 166111427 |
| Molecular Formula | C32H31N2O4P |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 2-[1-[3,6-dimethyl-2-(3-methylphenyl)-4-oxochromen-8-yl]ethylamino]benzoic acid;(Z)-2-(phosphanylidenemethyl)but-2-enenitrile |
| SMILES | Cc1cccc(-c2oc3c(C(C)Nc4ccccc4C(=O)O)cc(C)cc3c(=O)c2C)c1.[H]/P=C/C(C#N)=C\C |
| InChI | InChI=1S/C27H25NO4.C5H6NP/c1-15-8-7-9-19(12-15)25-17(3)24(29)22-14-16(2)13-21(26(22)32-25)18(4)28-23-11-6-5-10-20(23)27(30)31;1-2-5(3-6)4-7/h5-14,18,28H,1-4H3,(H,30,31);2,4,7H,1H3/b;5-2- |
| InChIKey | HNZRRXSIJRUUER-HKMNGLQQSA-N |
| XLogP | 7.66 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|