C30H26N4O4 — CID 166111726
2-[1-[2-[(Z)-1-[(4-cyanophenyl)methyldiazenyl]prop-1-enyl]-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid (PubChem CID 166111726) has the molecular formula C30H26N4O4 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-[1-[2-[(Z)-1-[(4-cyanophenyl)methyldiazenyl]prop-1-enyl]-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid.
| Compound Name | 2-[1-[2-[(Z)-1-[(4-cyanophenyl)methyldiazenyl]prop-1-enyl]-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid |
|---|---|
| PubChem CID | 166111726 |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[1-[2-[(Z)-1-[(4-cyanophenyl)methyldiazenyl]prop-1-enyl]-6-methyl-4-oxochromen-8-yl]ethylamino]benzoic acid |
| SMILES | C/C=C(\N=N\Cc1ccc(C#N)cc1)c1cc(=O)c2cc(C)cc(C(C)Nc3ccccc3C(=O)O)c2o1 |
| InChI | InChI=1S/C30H26N4O4/c1-4-25(34-32-17-21-11-9-20(16-31)10-12-21)28-15-27(35)24-14-18(2)13-23(29(24)38-28)19(3)33-26-8-6-5-7-22(26)30(36)37/h4-15,19,33H,17H2,1-3H3,(H,36,37)/b25-4-,34-32+ |
| InChIKey | BMJHYMFUXQCZHS-URUOAWPASA-N |
| XLogP | 6.86 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|