C21H21NO4S — CID 170694703
2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]benzoic acid (PubChem CID 170694703) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 170694703 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]benzoic acid |
| SMILES | CCSc1cc(=O)c2cc(C)cc([C@@H](C)Nc3ccccc3C(=O)O)c2o1 |
| InChI | InChI=1S/C21H21NO4S/c1-4-27-19-11-18(23)16-10-12(2)9-15(20(16)26-19)13(3)22-17-8-6-5-7-14(17)21(24)25/h5-11,13,22H,4H2,1-3H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | ZDHCHXJWMQYDLX-CYBMUJFWSA-N |
| XLogP | 5.08 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |