C21H20FNO4S — CID 166146858
2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]-6-fluorobenzoic acid (PubChem CID 166146858) has the molecular formula C21H20FNO4S and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]-6-fluorobenzoic acid.
| Compound Name | 2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 166146858 |
| Molecular Formula | C21H20FNO4S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[[(1R)-1-(2-ethylsulfanyl-6-methyl-4-oxochromen-8-yl)ethyl]amino]-6-fluorobenzoic acid |
| SMILES | CCSc1cc(=O)c2cc(C)cc([C@@H](C)Nc3cccc(F)c3C(=O)O)c2o1 |
| InChI | InChI=1S/C21H20FNO4S/c1-4-28-18-10-17(24)14-9-11(2)8-13(20(14)27-18)12(3)23-16-7-5-6-15(22)19(16)21(25)26/h5-10,12,23H,4H2,1-3H3,(H,25,26)/t12-/m1/s1 |
| InChIKey | WTJBKIXYHMIFPF-GFCCVEGCSA-N |
| XLogP | 5.22 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |