C38H46N8O3 — CID 166112412
3-[6-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione (PubChem CID 166112412) has the molecular formula C38H46N8O3 and a molecular weight of 662.84 g/mol. Its IUPAC name is 3-[6-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166112412 |
| Molecular Formula | C38H46N8O3 |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | 3-[6-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
| SMILES | CC1(C)CCc2c(-c3cc4ccc(C(=O)N5CCN(CC6CCN(c7ccc(C8CCC(=O)NC8=O)cn7)CC6)CC5)cc4[nH]3)n[nH]c2C1 |
| InChI | InChI=1S/C38H46N8O3/c1-38(2)12-9-29-32(21-38)42-43-35(29)31-19-25-3-4-26(20-30(25)40-31)37(49)46-17-15-44(16-18-46)23-24-10-13-45(14-11-24)33-7-5-27(22-39-33)28-6-8-34(47)41-36(28)48/h3-5,7,19-20,22,24,28,40H,6,8-18,21,23H2,1-2H3,(H,42,43)(H,41,47,48) |
| InChIKey | YQUVLKNJEDWTEH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|