C39H48N8O3 — CID 166113422
3-[6-[4-[[(3R)-4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]-3-methylpiperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione (PubChem CID 166113422) has the molecular formula C39H48N8O3 and a molecular weight of 676.87 g/mol. Its IUPAC name is 3-[6-[4-[[(3R)-4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]-3-methylpiperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[(3R)-4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]-3-methylpiperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166113422 |
| Molecular Formula | C39H48N8O3 |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | 3-[6-[4-[[(3R)-4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-6-carbonyl]-3-methylpiperazin-1-yl]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
| SMILES | C[C@@H]1CN(CC2CCN(c3ccc(C4CCC(=O)NC4=O)cn3)CC2)CCN1C(=O)c1ccc2cc(-c3n[nH]c4c3CCC(C)(C)C4)[nH]c2c1 |
| InChI | InChI=1S/C39H48N8O3/c1-24-22-45(23-25-11-14-46(15-12-25)34-8-6-28(21-40-34)29-7-9-35(48)42-37(29)49)16-17-47(24)38(50)27-5-4-26-18-32(41-31(26)19-27)36-30-10-13-39(2,3)20-33(30)43-44-36/h4-6,8,18-19,21,24-25,29,41H,7,9-17,20,22-23H2,1-3H3,(H,43,44)(H,42,48,49)/t24-,29?/m1/s1 |
| InChIKey | OBMWJYIQLQNBTB-OEXUWWALSA-N |
| XLogP | 5.05 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|