C38H45FN8O3 — CID 167474722
1-[4-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-5-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-2-fluorophenyl]-1,3-diazinane-2,4-dione (PubChem CID 167474722) has the molecular formula C38H45FN8O3 and a molecular weight of 680.83 g/mol. Its IUPAC name is 1-[4-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-5-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-2-fluorophenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-5-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-2-fluorophenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167474722 |
| Molecular Formula | C38H45FN8O3 |
| Molecular Weight | 680.83 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | 1-[4-[4-[[4-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indole-5-carbonyl]piperazin-1-yl]methyl]piperidin-1-yl]-2-fluorophenyl]-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)CCc2c(-c3cc4cc(C(=O)N5CCN(CC6CCN(c7ccc(N8CCC(=O)NC8=O)c(F)c7)CC6)CC5)ccc4[nH]3)n[nH]c2C1 |
| InChI | InChI=1S/C38H45FN8O3/c1-38(2)11-7-28-32(22-38)42-43-35(28)31-20-26-19-25(3-5-30(26)40-31)36(49)46-17-15-44(16-18-46)23-24-8-12-45(13-9-24)27-4-6-33(29(39)21-27)47-14-10-34(48)41-37(47)50/h3-6,19-21,24,40H,7-18,22-23H2,1-2H3,(H,42,43)(H,41,48,50) |
| InChIKey | IQQCWWGDLFINMQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.83 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |